|
Remdesivir, 99.93% |
|
Synonyms |
GS-5734 |
|
Appearance |
Solid |
|
Color |
Off-white to yellow |
|
SMILES |
C[C@H](N[P@@](OC1=CC=CC=C1)(OC[C@H]2O[C@@](C#N)(C3=CC=C4C(N)=NC=NN43)[C@H](O)[C@@H]2O)=O)C(OCC(CC)CC)=O |
|
Purity |
99.93% |
|
Storage |
Powder -20°C, 3 years ; In solvent -80°C, 6 months , -20°C, 1 month |
|
Description |
Remdesivir (GS-5734) is a nucleoside analogue with effective antiviral activity. Remdesivir can inhibit the synthesis of viral DNA or RNA. Remdesivir can be used for the research of infection, such as SARS-CoV and MHV infection |
|
Remdesivir, ≥98%, Cell Culture |
|
Appearance |
Off-white to yellow Solid |
|
Solubility |
Soluble in DMSO |
|
Purity |
≥98% |
|
Grade |
Cell Culture |
|
SMILES |
N#C[C@@]1(C2=CC=C3N2N=CN=C3N)O[C@H](COP(OC4=CC=CC=C4)(N[C@@H](C)C(OCC(CC)CC)=O)=O)[C@@H](O)[C@H]1O |
|
InChIKey |
RWWYLEGWBNMMLJ-YSOARWBDSA-N |
|
InChI |
InChI=1S/C27H35N6O8P/c1-4-18(5-2)13-38-26(36)17(3)32-42(37，41-19-9-7-6-8-10-19)39-14-21-23(34)24(35)27(15-28，40-21)22-12-11-20-25(29)30-16-31-33(20)22/h6-12，16-18，21，23-24，34-35H，4-5，13-14H2，1-3H3，(H，32，37)(H2，29，30，31)/t17-，21+，23+，24+，27-，42-/m0/s1 |
|
Target Point |
Influenza Virus SARS-CoV |
|
Passage |
Anti-infection |
|
Background |
Remdesivir is a nucleoside analog with antiviral activity. |
|
Storage |
Powder:-20℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
|
Pack Size |
1 MG | 5 MG | 10 MG |
|
Remdesivir, 99% |
|
Synonyms |
2-Ethylbutyl ((S)-(((2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxytetrahydrofuran-2-yl)methoxy)(phenoxy)phosphoryl)-L-alaninate |
|
Purity |
99% |
|
SMILES Code |
C[C@@H](C(OCC(CC)CC)=O)N[P@@](OC1=CC=CC=C1)(OC[C@H]2O[C@@](C#N)(C3=CC=C4C(N)=NC=NN43)[C@H](O)[C@@H]2O)=O |
|
Storage |
Keep in dark place, sealed in dry, 2-8°C |
|
Pack Size |
1 MG | 10 MG | 250 MG | 1 GM | 5 GM | 25 GM | 100 GM |
