Novel o-quinone coenzyme found in bacterial dehydrogenases and oxidases. Pyrroloquinoline Quinone (PQQ), also referred as methoxatin, is a water soluble orthoquinone molecule with redox-cycling ability.
| Pyrroloquinoline quinone - Specification | |
| Synonym(s) | 4,5-Dihydro-4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylic acid, Methoxatin, PQQ |
| Quality Level | 200 |
| biological source | synthetic |
| Assay | ≥95.0% (HPLC) |
| form | powder |
| color | red to deep red |
| InChI key | MMXZSJMASHPLLR-UHFFFAOYSA-N |
| SMILES string | OC(=O)c1cc(C(O)=O)c-2c(n1)C(=O)C(=O)c3cc([nH]c-23)C(O)=O |
| InChI | 1S/C14H6N2O8/c17-10-4-2-6(14(23)24)15-8(4)7-3(12(19)20)1-5(13(21)22)16-9(7)11(10)18/h1-2,15H,(H,19,20)(H,21,22)(H,23,24) |
| technique(s) | HPLC: suitable, gas chromatography (GC): suitable |
| storage temp. | 2-8°C |