| Melatonin, 99% - Puriss | |
| Synonyms | N-Acetyl-5-methoxytryptamine |
| Categories | Biochemicals & reagents, Enzyme inhibitors |
| Grade | Puriss |
| HSN Code | 29224990 |
| Assay | 99%+ |
| Appearance (Form) | Powder |
| Appearance (Colour) | White to off-white |
| Melting point | 116.5-118 °C(lit.) |
| Solubility | Ethanol: soluble 50 mg/mL |
| Pack Size | 100 GM | 25 GM | 1 GM | 5 GM |
| Melatonin, 97% | |
| Synonyms | N-Acetyl-5-methoxytryptamine; NSC 56423; 5-Methoxy-N-acetyltryptamine N-(2-(5-Methoxy-1H-indol-3-yl)ethyl)acetamide |
| Purity | 97% |
| SMILES Code | COC1=CC2=C(NC=C2CCNC(C)=O)C=C1 |
| Storage | Keep in dark place, inert atmosphere, store in freezer, under -20°C |
| Pack Size | 5 GM | 10 GM | 25 GM | 100 GM | 500 GM |
Melatonin
CAS No: 73-31-4
| Catalouge No | BSCHM-021M |
| Mol. Formula | C13H16N2O2 |
| Mol. Weight | 232.28 |
| Price | POR |
Melatonin is an indoleamine neurohormone found across plants and animals, produced endogenously from serotonin (5-HT) and secreted in animals as a regulatory signal for synchronization of the circadian rhythm and the sleep-wake cycle
Melatonin, 99% - used as an antioxidant. Melatonin is involved in many biological functions such as circadian rhythm, sleep, the stress response, aging, and immunity.
- WGK Germany 2