|
Linagliptin |
|
Appearance |
White to off-white Solid |
|
Purity |
≥98% |
|
Solubility |
Soluble in DMSO ≥10mg/mL |
|
Grade |
Cell Culture |
|
SMILES |
CC#CCN1C2=C(N=C1N3CCCC(C3)N)N(C(=O)N(C2=O)CC4=NC5=CC=CC=C5C(=N4)C)C |
|
InChIKey |
LTXREWYXXSTFRX-QGZVFWFLSA-N |
|
InChI |
InChI=1S/C25H28N8O2/c1-4-5-13-32-21-22(29-24(32)31-12-8-9-17(26)14-31)30(3)25(35)33(23(21)34)15-20-27-16(2)18-10-6-7-11-19(18)28-20/h6-7，10-11，17H，8-9，12-15，26H2，1-3H3/t17-/m1/s1 |
|
Target Point |
Dipeptidyl Peptidase(DPP-4) |
|
Passage |
Metabolic Enzyme&Protease |
|
Background |
Linagliptin is an effective and selective DPP-4 inhibitor. |
|
Biological Activity |
Linagliptin is a highly potent， selective DPP-4 inhibitor with IC50 of 1 nM.[1-4] |
|
IC50 |
IC50: 1 nM (DPP-4)[1-4] |
|
Storage |
Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃ |
|
Pack Size |
100 MG | 500 MG | 1 GM |
