Dimethyl sulfoxide-d6 is a deuterated NMR solvent that is useful in NMR-based research and analyses.
| Dimethyl sulfoxide-d6 - Specification | |
| Synonym(s) | (Methyl sulfoxide)-d6, DMSO-d6, Hexadeuterodimethyl sulfoxid |
| vapor pressure | 0.42 mmHg ( 20 °C) |
| Quality Level | 200 |
| isotopic purity | 99.9 atom % D |
| assay | 99% (CP) |
| form | liquid |
| autoignition temp. | 573 °F |
| contains | 0.03 % (v/v) TMS |
| expl. lim. | 42 % |
| technique(s) | NMR: suitable |
| impurities | ≤0.0250% water |
| refractive index | n20/D 1.476 (lit.) |
| bp | 189 °C (lit.) |
| mp | 20.2 °C (lit.) |
| density | 1.190 g/mL at 25 °C (lit.) |
| mass shift | M+6 |
| SMILES string | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| InChI | 1S/C2H6OS/c1-4(2)3/h1-2H3/i1D3,2D3 |
| InChI key | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |