|
Demethoxycurcumin - Specification |
|
Solubility |
Soluble in DMSO |
|
Purity |
HPLC≥98% |
|
Grade |
Cell Culture |
|
Appearance |
Light yellow to yellow Solid |
|
Storage |
Powder:2-8℃,2 years;Insolvent(Mother Liquid):-20℃,6 months;-80℃,1 year |
|
SMILES |
O=C(CC(/C=C/C1=CC=C(O)C=C1)=O)/C=C/C2=CC=C(O)C(OC)=C2 |
|
InChIKey |
HJTVQHVGMGKONQ-LUZURFALSA-N |
|
InChI |
InChI=1S/C20H18O5/c1-25-20-12-15(6-11-19(20)24)5-10-18(23)13-17(22)9-4-14-2-7-16(21)8-3-14/h2-12,21,24H,13H2,1H3/b9-4+,10-5+ |
|
Passage |
Immunology & Inflammation |
|
Background |
Demethoxycurcumin, a major active ingredient of curcumin, has been shown to have anti-inflammatory and toxic effects on cancer cells. |