| D-Galactose, 99% HPLC | |
| Synonym(s) | Galactose |
| Grade | HPLC |
| biological source | bovine (Ruminant- Cow, Ox, Buffalo) |
| Quality Segment | 300 |
| assay | ≥99% (HPLC) |
| form | powder |
| technique(s) | HPLC: suitable |
| impurities | ≤0.1% glucose |
| color | white |
| useful pH range | 5.0-7 (25 °C, 180 g/L) |
| mp | 168-170 °C (lit.) |
| solubility | H2O: soluble 100 mg/mL, clear, colorless |
| storage temp. | room temp |
| SMILES string | OC[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C=O |
| InChI | 1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5+,6-/m0/s1 |
| InChI key | GZCGUPFRVQAUEE-KCDKBNATSA-N |
| Pack Size | 10 MG | 10 GM | 25 GM | 50 GM | 100 GM | 500 GM |
| D-Galactose, 99% | |
| Categories | Biochemicals & reagents, Carbohydrates A to Z |
| Grade | Extra Pure |
| HSN Code | 29400000 |
| Assay | ≥99% |
| Appearance (Form) | Powder or crystals or chunks |
| Appearance (Colour) | White |
| Melting point | 168-170 °C(lit.) |
| Specific rotation | 80° + 1 |
| Loss on drying | <1.0% |
| Pack Size | 100 GM | 500 GM | 25 GM |
D-Galactose
CAS No: 59-23-4
| Catalouge No | BSCHM-021D |
| Mol. Formula | C6H12O6 |
| Mol. Weight | 180.16 |
| Price | Por |
Galactose, sometimes abbreviated Gal, is a monosaccharide sugar that is less sweet than glucose and fructose.
D-Galactose - used as a component of galactosyltransferase labeling buffer. As a supplement in MRS broth for the growth of thermophilic lactobacilli, to induce the expression of uncoupling protein (UCP) in yeast transformants.
Galactose (HPLC) has been used:
- as a component of galactosyltransferase labeling buffer
- as a supplement in MRS broth for the growth of thermophilic lactobacilli
- to induce the expression of uncoupling protein (UCP) in yeast transformants