|
Busulfan - Details |
|
Appearance |
White to off-white Solid |
|
Solubility |
Soluble in DMSO ≥15mg/mL |
|
Purity |
HPLC ≥ 98% |
|
SMILES |
CS(=O)(OCCCCOS(C)(=O)=O)=O |
|
InChIKey |
COVZYZSDYWQREU-UHFFFAOYSA-N |
|
InChI |
InChI=1S/C6H14O6S2/c1-13(7,8)11-5-3-4-6-12-14(2,9)10/h3-6H2,1-2H3 |
|
Storage |
Powder:2-8℃, 2 years;Insolvent(Mother Liquid):-20℃, 6 months;-80℃, 1 year |
|
Biological Activity |
Busulfan is an effective alkylating agent with chemotherapeutic effects. |
|
Target Point |
DNA Alkylator |
|
Background |
Busulfan is an effective alkylator. It is a bifunctional alkylating agent of bismethyl sulfonate and is a cell cycle non-specific compound. It disrupts the structure and function of DNA by alkylating guanines in cellular DNA |
