|
Bisdemethoxycurcumin - Specification |
|
Appearance |
Off-white to yellow Solid |
|
Purity |
HPLC ≥ 98% |
|
Solubility |
Soluble in DMSO ≥3 mg/mL |
|
Grade |
Cell Culture |
|
SMILES |
O=C(CC(/C=C/C1=CC=C(O)C=C1)=O)/C=C/C2=CC=C(O)C=C2.[E].[E] |
|
InChIKey |
PREBVFJICNPEKM-YDWXAUTNSA-N |
|
InChI |
InChI=1S/C19H16O4/c20-16-7-1-14(2-8-16)5-11-18(22)13-19(23)12-6-15-3-9-17(21)10-4-15/h1-12, 20-21H, 13H2/b11-5+, 12-6+ |
|
Target Point |
Others |
|
Passage |
Others |
|
Background |
Bisdemethoxycurcumin is a curcumin derivative with anti-inflammatory and anticancer activity. |
|
Biological Activity |
Bisdemethoxycurcumin (BDMC) is a naturally occurring curcumin demethoxylated derivative with various biological activities, such as anti-inflammatory and anticancer activities |
|
Storage |
Powder:2-8℃, 2 years;Insolvent(Mother Liquid):-20℃, 6 months;-80℃, 1 year |
Reviews
There are no reviews yet.