|
Bafilomycin A1 - Specification |
|
Appearance |
White to yellow Solid |
|
Solubility |
Soluble in DMSO |
|
Purity |
≥95% |
|
Grade |
Cell Culture |
|
Target Point |
Proton Pump;H+-ATPase |
|
Passage |
Autophagy |
|
SMILES |
C[C@H]([C@](O[C@@H]1C(C)C)(C[C@@H](O)[C@@H]1C)O)[C@H](O)[C@@H]([C@](OC(/C(OC)=C/C(C)=C\[C@@H](C)[C@@H](O)[C@@H](C)C2)=O)([H])[C@H](/C=C/C=C2\C)OC)C |
|
InChIKey |
XDHNQDDQEHDUTM-JQWOJBOSSA-N |
|
InChI |
InChI=1S/C35H58O9/c1-19(2)32-24(7)27(36)18-35(40，44-32)26(9)31(38)25(8)33-28(41-10)14-12-13-20(3)15-22(5)30(37)23(6)16-21(4)17-29(42-11)34(39)43-33/h12-14，16-17，19，22-28，30-33，36-38，40H，15，18H2，1-11H3/b14-12+，20-13+，21-16+，29-17-/t22-，23+，24-，25-，26-，27+，28-，30-，31+，32+，33+，35+/m0/s1 |
|
Storage |
|
Background |
|
Bafilomycin A1 is a macrolide antibiotic and a specific reversible V-ATPase inhibitor. Bafilomycin A1 is a late-stage inhibitor of autophagy, blocking the fusion of autophagosomes with lysosomes. Bafilomycin A1 also induces apoptosis |
Reviews
There are no reviews yet.