| Ammonium Sodium Phosphate Dibasic Tetrahydrate | |
| Synonyms | sec-Sodium ammonium phosphate, Ammonium sodium hydrogen phosphate, Sodium ammonium hydrogen phosphate |
| Quality Segment | 100 |
| Assay | ≥99% |
| Form | Powder |
| SMILES string | [NH4+].[Na+].OP([O-])([O-])=O |
| InChI | 1S/H3N.Na.H3O4P.4H2O/c;;1-5(2,3)4;;;;/h1H3;;(H3,1,2,3,4);4*1H2/q;+1;;;;;/p-1 |
| InChI key | IQTQISLCLWJRPM-UHFFFAOYSA-M |
| Pack Size | 100 GM | 500 GM | 1 KG |
Ammonium Sodium Phosphate Dibasic Tetrahydrate
CAS No: 7783-13-3
| Catalogue No | BSCHM-066A |
| Mol. Formula | NaNH4HPO4 · 4H2O |
| Mol. Weight | 209.07 |
| Price | POR |
Ammonium sodium phosphate dibasic tetrahydrate can beused as a nitrogen and phosphorous source to synthesize biopolymers such as polyhydroxyalkanoate (a biodegradable plastic).
PHAs Producing Bacteria Isolated from Waste Cooking Oil: Isolation and Characterization
This study involves the utilization of ammonium sodium phosphate dibasic tetrahydrate among other phosphate salts in the preparation of media for the growth of bacteria isolated from waste cooking oil