|
Bromobimane - Details |
|
Appearance |
Light yellow to yellow Solid |
|
Solubility |
Soluble in DMSO ā„5mg/mL(Need ultrasonic) |
|
Purity |
ā„98% |
|
SMILES |
CC1=C(N2C(=C(C(=O)N2C1=O)C)CBr)C |
|
InChIKey |
AHEWZZJEDQVLOP-UHFFFAOYSA-N |
|
InChI |
InChI=1S/C10H11BrN2O2/c1-5-7(3)12-8(4-11)6(2)10(15)13(12)9(5)14/h4H2ļ¼1-3H3 |
|
Storage |
Powder:2-8ā, 2 years;Insolvent(Mother Liquid):-20ā, 6 months;-80ā, 1 year |
|
Background |
Ex(nm)=395/Em(nm)=490(Bromobimane is one of the sulfhydryl reactive fluorescent labeling dyes widely used for the detection of various thiol-containing biomolecules in cells, such as glutathione. |
