SF7-AM is a cell-trappable fluorogenic probe for the detection of hydrogen sulfide (H2S).1 Following entry into cells, cleavage of the acetoxymethyl ester groups by intracellular esterases results in an anionic charge, trapping the probe inside the cells. Reaction of the azide moieties with H2S in buffers or live cells leads to generation of carboxamide rhodamine 110, which displays excitation/emission maxima of 498/526 nm, respectively.
| Sulfidefluor-7 acetoxymethyl ester (SF7-AM) - Details | |
| Formal Name | N-[2-[(acetyloxy)methoxy]-2-oxoethyl]-N-[(3',6'-diazido-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthen]-5-yl)carbonyl]-glycine, (acetyloxy)methyl ester |
| Synonyms | Sulfidefluor-7 acetoxymethyl ester |
| Purity | ≥95% |
| Emission | 526 nm |
| Excitation | 498 nm |
| Formulation | A crystalline solid |
| Solubility | DMF: 10 mg/ml, DMF:PBS (pH 7.2) (1:1): 0.5 mg/ml, DMSO: 5 mg/ml |
| λmax | 234 nm |
| SMILES | O=C(O1)C2=C(C=CC(C(N(CC(OCOC(C)=O)=O)CC(OCOC(C)=O)=O)=O)=C2)C31C4=C(C=C(N=[N+]=[N-])C=C4)OC5=C3C=CC(N=[N+]=[N-])=C5 |
| InChi Code | InChI=1S/C31H23N7O12/c1-16(39)45-14-47-27(41)12-38(13-28(42)48-15-46-17(2)40)29(43)18-3-6-22-21(9-18)30(44)50-31(22)23-7-4-19(34-36-32)10-25(23)49-26-11-20(35-37-33)5-8-24(26)31/h3-11H,12-15H2,1-2H3 |
| InChi Key | QIAZHSBWGCYJGQ-UHFFFAOYSA-N |
| Storage | -20°C |


