| G-418 Disulfate | |
| Appearance | White to off-white Solid |
| Grade | Cell Culture |
| Purity | ≥98% |
| Trspt Condition | Cold Transport |
| SMILES | O[C@@H]1[C@@H]([C@H](O)C)O[C@H](O[C@H]2[C@H](O)[C@@H](O[C@@H]3[C@H](O)[C@@H](NC)[C@@](C)(O)CO3)[C@H](N)C[C@@H]2N)[C@H](N)[C@H]1O.O=S(O)(O)=O.O=S(O)(O)=O |
| InChIKey | UHEPSJJJMTWUCP-NKCAIAFTSA-N |
| InChI | InChI=1S/C20H40N4O10.2H2O4S/c1-6(25)14-11(27)10(26)9(23)18(32-14)33-15-7(21)4-8(22)16(12(15)28)34-19-13(29)17(24-3)20(2,30)5-31-19;2*1-5(2,3)4/h6-19,24-30H,4-5,21-23H2,1-3H3;2*(H2,1,2,3,4)/t6?,7-,8+,9+,10+,11-,12-,13-,14+,15+,16-,17-,18+,19-,20+;;/m0../s1 |
| Target Point | Bacterial |
| Passage | Anti-infection |
| Background | It is an aminoglycoside antibiotic, which is the most commonly used resistance screening reagent for stable transfection. |
| Storage | Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃ |
| Size | 100 MG | 500 MG | 1 GM |
G-418 Disulfate
CAS No：108321-42-2
| Catalouge No | BSCHM-037G |
| Mol. Formula | C20H40N4O10·2H2SO4 |
| Mol. Weight | 692.71 |
| Price | POR |