|
Lufenuron |
|
Appearance |
Solid |
|
Solubility |
Soluble in DMSO ≥12mg/mL |
|
SMILES |
C1=CC(=C(C(=C1)F)C(=O)NC(=O)NC2=CC(=C(C=C2Cl)OC(C(C(F)(F)F)F)(F)F)Cl)F |
|
InChIKey |
PWPJGUXAGUPAHP-UHFFFAOYSA-N |
|
InChI |
InChI=1S/C17H8Cl2F8N2O3/c18-6-5-11(32-17(26,27)14(22)16(23,24)25)7(19)4 -10(6)28-15(31)29-13(30)12-8(20)2-1-3-9(12)21/h1-5, 14H, (H2, 28, 29, 30, 31) |
|
Background |
It is reported that Lufenuron is a lipophilic benzoylurea insecticide and chitin synthesis inhibitor that can be used for the control of fleas and fish lice. Lufenuron can inhibit the molting of arthropods. |
|
Storage |
Powder:-20℃, 2 years;Insolvent(Mother Liquid) |
|
Pack Size |
100 MG | 500 MG | 1 GM |
